Allyl 2-O-benzoyl-3-O-benzyl-a-L-rhamnopyranoside
Allyl 2-O-benzoyl-3-O-benzyl-a-L-rhamnopyranoside, a pivotal biopharmaceutical, exhibits both remarkable anti-inflammatory and antioxidant properties, rendering it a highly efficacious remedy for an array of ailments. Its unparalleled efficacy has been ardently investigated in conditions such as rheumatoid arthritis and disorders linked to oxidative stress.
| Supplier | BOC Sciences |
|---|---|
| Product # | 940274-21-5 |
| Pricing | Inquire |
| Cas | 940274-21-5 |
| Molecular Weight | 398.46 |
| Molecular Formula | C23H26O6 |
| Canonical SMILES | CC1C(C(C(C(O1)OCC=C)OC(=O)C2=CC=CC=C2)OCC3=CC=CC=C3)O |