8-Bromo-2',3',5'-tri-O-acetylguanosine
8-Bromo-2',3',5'-tri-O-acetylguanosine is an exquisitely intricate and exceptionally useful biochemical compound, tailored with intrinsic antiviral capabilities. It is revered for its profound potential in dissecting the intricate dynamics of viral RNA-dependent RNA polymerases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15717-45-0 |
| Pricing | Inquire |
| Cas | 15717-45-0 |
| Molecular Weight | 488.25 |
| Molecular Formula | C16H18BrN5O8 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)N=C2Br)OC(=O)C)OC(=O)C |