1-Isobutylpyrazole-4-boronic acid pinacol ester
1-Isobutylpyrazole-4-boronic acid pinacol ester is a crucial compound utilized in the synthesis of bioactive molecules. It's particularly significant in the production of pharmaceuticals targeting cancer treatment, due to its ability to interfere with certain crucial cellular processes in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 827614-66-4 |
| Pricing | Inquire |
| Cas | 827614-66-4 |
| Molecular Weight | 250.15 |
| Molecular Formula | C13H23BN2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(C)C |