Aurora Kinase Inhibitor II
The Aurora kinases are a family of serine/threonine kinases that are key regulators of mitosis and cytokinesis. Aurora kinase inhibitor II is a cell-permeable anilinoquinazoline that blocks the activity of Aurora A with IC50 of 0.39 µM. This compound has the ability to permeate the cell and is involved in the regulation of the cell cycle, particularly cell division. This compound has the ability to permeate the cell and is involved in the regulation of the cell cycle, particularly cell division.
| Supplier | BOC Sciences |
|---|---|
| Product # | 331770-21-9 |
| Pricing | Inquire |
| Cas | 331770-21-9 |
| Molecular Weight | 400.4 |
| Molecular Formula | C23H20N4O3 |
| Canonical SMILES | COC1=C(OC)C=C(C(NC2=CC=C(NC(C3=CC=CC=C3)=O)C=C2)=NC=N4)C4=C1 |