Phenyl 4,6-O-benzylidene-b-D-thiogalactopyranoside
Phenyl 4,6-O-benzylidene-b-D-thiogalactopyranoside is a biochemical compound widely used in the biomedical industry acting as a substrate analogue for various enzymes and aids in the study of glycosidase activity. This compound finds utility in researching and developing drugs for the research of diseases related to glycosidase metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 138922-03-9 |
| Pricing | Inquire |
| Cas | 138922-03-9 |
| Molecular Weight | 360.42 |
| Molecular Formula | C19H20O5S |
| Canonical SMILES | C1C2C(C(C(C(O2)SC3=CC=CC=C3)O)O)OC(O1)C4=CC=CC=C4 |