2'-Deoxy-2'-fluoro-5-ethyl-arabinouridine
2'-Deoxy-2'-fluoro-5-ethyl-arabinouridine is a potent antiviral nucleoside analog used in the treatment of viral infections, specifically targeting RNA viruses. It inhibits viral replication by incorporating into viral RNA and terminating its synthesis. This product is commonly used in biomedical research to study the mechanisms of viral replication and to develop new antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83546-42-3 |
| Pricing | Inquire |
| Cas | 83546-42-3 |
| Molecular Weight | 274.25 |
| Molecular Formula | C11H15FN2O5 |
| Canonical SMILES | CCC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)F |