Liothyronine-[13C6]
Liothyronine-[13C6] is a thyroid hormone involved in many physiological processes in the human body including growth and development, metabolism, body temperature and heart rate. This internal standard is suitable for quantitation of free and total T3 serum levels by LC-MS/MS for determination of hyperthyroidism caused by excess T3.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004356 |
| Pricing | Inquire |
| Cas | 1213431-76-5 |
| Molecular Weight | 656.93 |
| Molecular Formula | C9[13C]6H12I3NO4 |
| Canonical SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O |