2,4-O-Benzylidene-D-glucitol
2,4-O-Benzylidene-D-glucitol, a compound of profound significance in the biomedical landscape, finds extensive application. Serving as the foundational constituent, it embarks on the journey of synthesizing a myriad of pharmaceuticals, notably antiviral and anticancer agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61340-09-8 |
| Pricing | Inquire |
| Cas | 61340-09-8 |
| Molecular Weight | 270.28 |
| Molecular Formula | C13H18O6 |
| Canonical SMILES | C1=CC=C(C=C1)C2OC(C(C(O2)C(CO)O)O)CO |