4-Nitrophenyl b-L-arabinopyranoside
4-Nitrophenyl b-L-arabinopyranoside is a valuable substrate for biomedical applications, specifically in the measurement of glycoside hydrolase activity, such as β-D-arabinofuranosidase, in drug discovery and enzymatic studies. Additionally, it is utilized in the study of L-arabinose and xylose metabolism in bacteria and fungi, and elucidates their relevance to pathways implicated in diseases including diabetes. Through utilization of this specialized substrate, significant advances can be made in the fields of biomedicine and microbiology research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72732-54-8 |
| Pricing | Inquire |
| Cas | 72732-54-8 |
| Molecular Weight | 271.22 |
| Molecular Formula | C11H13NO7 |
| Canonical SMILES | C1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |