Dexamethasone Sodium phosphate Impurity B
Dexamethasone Sodium phosphate Impurity B is an impurity of Dexamethasone Sodium phosphate, a preeminent corticosteroid therapeutic drug for treating a myriad of complicated inflammatory ailments, hypersensitivity responses and sundry malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 360-63-4 |
| Pricing | Inquire |
| Cas | 360-63-4 |
| Molecular Weight | 472.45 |
| Molecular Formula | C22H30FO8P |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)(O)O)O)C)O)F)C |