4-Nitrophenyl b-D-galactofuranoside
4-Nitrophenyl b-D-galactofuranoside is a specialized component extensively used in the biomedical industry. This compound is employed in research investigations to study galactofuranosyl transferases and related enzymes involved in the metabolism of galactofuranose-containing polysaccharides.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100645-45-2 |
| Pricing | Inquire |
| Cas | 100645-45-2 |
| Molecular Weight | 301.25 |
| Molecular Formula | C12H15NO8 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(O2)C(CO)O)O)O |