D-Fructose-2,6-diphosphate sodium salt
D-Fructose-2,6-diphosphate sodium salt is a vital compound in biomedicine used as a metabolic regulator. It plays a crucial role in the regulation of glycolysis and gluconeogenesis. D-Fructose-2,6-diphosphate sodium salt is employed in researching enzyme mechanisms, drug development targeting metabolic disorders, and in studying the treatment of diseases like diabetes and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84364-89-6 |
| Pricing | Inquire |
| Cas | 84364-89-6 |
| Molecular Weight | 362.10 |
| Molecular Formula | C6H13NaO12P2 |
| Canonical SMILES | C(C1C(C(C(O1)(C[O-])OP(=O)(O)O)O)O)OP(=O)(O)O.[Na+] |