L-Tetrahydrofolic Acid-[d4]
L-Tetrahydrofolic Acid-[d4] is the labelled analogue of L-Tetrahydrofolic Acid, which is a folic acid derivative. It is a cofactor in many bio-reactions, especially in the metabolism of amino acids and nucleic acids.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-006338 |
| Pricing | Inquire |
| Cas | 1356841-72-9 |
| Molecular Weight | 449.45 |
| Molecular Formula | C19H19D4N7O6 |
| Canonical SMILES | C1C(NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |