N6-Monobutyryl-2'-deoxyadenosine 3',5'-cyclic monophosphate sodium salt
N6-Monobutyryl-2'-deoxyadenosine 3',5'-cyclic monophosphate sodium salt, a biomedical marvel, takes center stage for addressing a myriad of ailments. Its profound influence on the intricate cellular signaling pathways, most notably the cyclic adenosine monophosphate (cAMP) pathway, cannot be overstated. Possessing the remarkable ability to function as both an agonist and antagonist, this molecular masterpiece orchestrates the modulation of cAMP-dependent processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 108347-96-2 |
| Pricing | Inquire |
| Cas | 108347-96-2 |
| Molecular Weight | 405.28 |
| Molecular Formula | C14H17N5O6P·Na |
| Canonical SMILES | CCCC(=O)NC1=C2C(=NC=N1)N(C=N2)C3CC4C(O3)COP(=O)(O4)[O-].[Na+] |