PTP Inhibitor IV
PTP inhibitor IV is an uncharged, 1,4-di-substituted, phenyl-linked bis-trifluoromethylsulfonamido phosphate mimetic that acts as a reversible, competitive, and active-site directed inhibitor of SHP-2, PTP1B, PTP-ε, PTP-Meg-2, PTP-σ, PTP-β, and PTP-µ (IC50s = 1.8, 2.5, 8.4, 13, 20, 6.4, and 6.7 µM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 329317-98-8 |
| Pricing | Inquire |
| Cas | 329317-98-8 |
| Molecular Weight | 608.6 |
| Molecular Formula | C26H26F6N2O4S2 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)C(C)(C)C2=CC=C(C=C2)NS(=O)(=O)C(F)(F)F)C3=CC=C(C=C3)NS(=O)(=O)C(F)(F)F |