7-Keto-DHEA acetate
Androst-5-en-3-ol-7,17-dione acetate, a steroid hormone and ester, is administered for treating hormone-responsive tumors, particularly breast cancer. Apart from that, it possesses androgenic properties and triggers an improvement in muscular strength and mass.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3065 |
| Pricing | Inquire |
| Cas | 1449-61-2 |
| Molecular Weight | 344.45 |
| Molecular Formula | C21H28O4 |
| Canonical SMILES | CC(=O)OC1CCC2(C3CCC4(C(C3C(=O)C=C2C1)CCC4=O)C)C |