7-Methoxycoumarin-3-carboxylic acid
7-Methoxycoumarin-3-carboxylic acid is a crucial compound used in the biomedical industry for research in drug development. It is commonly employed as a fluorescent probe to study drug metabolism, cellular transport, and drug-drug interactions. Additionally, it serves as a vital precursor in the synthesis of medicinally active coumarin derivatives used for treating various diseases, including cancer, diabetes, and inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20300-59-8 |
| Pricing | Inquire |
| Cas | 20300-59-8 |
| Molecular Weight | 220.18 |
| Molecular Formula | C11H8O5 |
| Canonical SMILES | COC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |