N-Amyl b-D-glucopyranoside
N-Amyl b-D-glucopyranoside, a vital compound extensively utilized in the biomedical field, emerges as a pivotal stabilizer and cryoprotectant during the preservation of proteins and enzymes. Its remarkable attributes encompass the prevention of protein denaturation and the preservation of enzyme activity. Hence, this product plays a significant role in safeguarding diverse pharmaceuticals employed for combating ailments like cancer, diabetes, and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66957-71-9 |
| Pricing | Inquire |
| Cas | 66957-71-9 |
| Molecular Weight | 250.29 |
| Molecular Formula | C11H22O6 |
| Canonical SMILES | CCCCCOC1C(C(C(C(O1)CO)O)O)O |