3'-O-Benzoyl-2'-deoxyuridine
3'-O-Benzoyl-2'-deoxyuridine, an indispensible biomedical compound, finds application in the realm of antiviral research and pharmaceutical innovation. Its paramount function encompasses curtailing viral replication, primarily targeting cytomegalovirus and herpes simplex virus. Endowed with a distinctive composition and intricate mechanism, this compound emerges as a promising contender for impeding viral afflictions and propelling advancements in the sphere of antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53213-02-8 |
| Pricing | Inquire |
| Cas | 53213-02-8 |
| Molecular Weight | 332.31 |
| Molecular Formula | C16H16N2O6 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)CO)OC(=O)C3=CC=CC=C3 |