Cuevaene A
It is produced by the strain of Streptomyces sp. HKI 0180. It has a moderate level of activity against gram-positive bacteria, Its MIC against Staphylococcus aureus and Bacillus subtilis is greater than 50 μg/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01089 |
| Pricing | Inquire |
| Cas | 1246172-08-6 |
| Molecular Weight | 354.40 |
| Molecular Formula | C21H22O5 |
| Canonical SMILES | CC(=CC1CCCC2=C1C3=C(O2)C=CC(=C3)O)C=C(C=CC(=O)O)OC |