A 779
A 779 is a specific antagonist of G-protein coupled receptor (Mas receptor) (IC50= 0.3 nM) with no significant affinity for AT1 or AT2 receptors at a concentration of 1 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 159432-28-7 |
| Pricing | 10 mg/unit USD $168 |
| Cas | 159432-28-7 |
| Molecular Weight | 872.97 |
| Molecular Formula | C39H60N12O11 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)NC(C)C(=O)O)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(C(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)N |