1-Amino-7,8-dihydro-8-oxo-9-(b-D-xylofuranosyl)guanine
1-Amino-7,8-dihydro-8-oxo-9-(b-D-xylofuranosyl)guanine, a potent antiviral agent, presents a therapeutic option to encumber viral infections, prominently herpes, by preventing viral DNA replication. The intricate mechanism of action of this drug precisely targets the viral genome, ensuring substantial inhibition of replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2389988-21-8 |
| Pricing | Inquire |
| Cas | 2389988-21-8 |
| Molecular Weight | 314.25 |
| Molecular Formula | C10H14N6O6 |
| Canonical SMILES | C(C1C(C(C(O1)N2C3=C(C(=O)N(C(=N3)N)N)NC2=O)O)O)O |