5-Fluoro-4'-thiouridine
5-Fluoro-4'-thiouridine is an influential pharmaceutical compound, used for studying diverse ailments, encompassing leukemia, pancreatic cancer and viral afflictions. Its inhibitory effects against both viruses and cancer cells are attributed to the inhibition of RNA enhancement and the initiation of apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 56527-42-5 |
| Pricing | Inquire |
| Cas | 56527-42-5 |
| Molecular Weight | 278.26 |
| Molecular Formula | C9H11FN2O5S |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(S2)CO)O)O)F |