17:1 Lyso PI ammonium salt
17:1 Lyso PI ammonium salt serves as a pivotal chemical agent in the intricate process of synthesizing varied phosphatidylinositol (PI) derivatives fundamental to numerous cellular signaling pathways. Noteworthy for its pivotal role in combating diverse ailments ranging from cancer to diabetes and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1246353-39-8 |
| Pricing | Inquire |
| Cas | 1246353-39-8 |
| Molecular Weight | 601.66 |
| Molecular Formula | C26H52NO12P |
| Canonical SMILES | CCCCCCC=CCCCCCCCCC(=O)OCC(COP(=O)([O-])OC1C(C(C(C(C1O)O)O)O)O)O.[NH4+] |