Benzomalvin B
It is produced by the strain of Penicillum sp. Benzomalvin B was isolated as an active inhibitor of substance P binding to mammalian neurokinin NK1 receptors. Benzomalvin B is a fungal metabolite produced by Penicillium. It acts as an antagonist of neurokinin-1 (NK1) receptors, inhibiting binding of substance P by 24% in vitro when used at a concentration of 100 μg/ml.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00630 |
| Pricing | Inquire |
| Cas | 157047-97-7 |
| Molecular Weight | 379.41 |
| Molecular Formula | C24H17N3O2 |
| Canonical SMILES | CN1C(=CC2=CC=CC=C2)C3=NC4=CC=CC=C4C(=O)N3C5=CC=CC=C5C1=O |