Hemopressin (human, mouse) acetate
Hemopressin (human, mouse) acetate, derived from the α1-chain of hemoglobin and originally isolated from rat brain homogenates, is a bioactive endogenous peptide substrate for endopeptidase 24.15, neurolysin and ACE (Ki = 27.76, 3.43 and 1.87 μM, respectively). It acts as a selective CB1 receptor inverse agonist with antinociceptive and hypotensive activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016379 |
| Pricing | Inquire |
| Molecular Weight | 1114.29 |
| Molecular Formula | C52H83N13O14 |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CC1=CN=CN1)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)N)NC(=O)C(C(C)C)NC(=O)C3CCCN3.CC(=O)O |