Peroxy Orange 1
Peroxy Orange 1 is a cell-permeable fluorescent sensor that is highly selective for detecting the presence of H2O2 in living cells. It exhibits an orange intracellular fluorescence in response to H2O2 signals produced in RAW 264.7 macrophages and A431 cells during immune response and growth factor stimulation, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1199576-10-7 |
| Pricing | Inquire |
| Cas | 1199576-10-7 |
| Molecular Weight | 521.41 |
| Molecular Formula | C32H32BNO5 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4(C5=CC=CC=C5C(=O)O4)C6=C(O3)C7=C8C(=C6)CCCN8CCC7 |