4-Methylphenyl b-D-thioglucopyranoside
4-Methylphenyl b-D-thioglucopyranoside is a crucial compound extensively used in the biomedical industry. It is commonly employed as a substrate in enzymatic assays, aiding in the study of enzyme kinetics and sugar metabolism. Furthermore, it proves valuable in the diagnosis and research of various diseases, particularly those related to abnormal carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1152-39-2 |
| Pricing | Inquire |
| Cas | 1152-39-2 |
| Molecular Weight | 286.35 |
| Molecular Formula | C13H18O5S |
| Canonical SMILES | CC1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)O |