6-O-[2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranosyl]-D-galactopyranose
6-O-[2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-b-D-glucopyranosyl]-D-galactopyranose, a highly intricate and complex carbohydrate derivative, is widely utilized within the biomedical field. Renowned for its remarkable potential, this compound plays a pivotal role in the advancement of pharmaceuticals, particularly in combatting a wide array of bacterial infections. By selectively impeding the proliferation of pathogenic bacteria, this unprecedented compound showcases its therapeutic efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20331-45-7 |
| Pricing | Inquire |
| Cas | 20331-45-7 |
| Molecular Weight | 545.49 |
| Molecular Formula | C20H35NO16 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCC2C(C(C(C(O2)O)O)O)O)CO)OC3C(C(C(C(O3)CO)O)O)O)O |