6-Azathymidine CEP
6-Azathymidine CEP, a fundamental component in the biomedical sector, demonstrates remarkable significance. Its utilization encompasses treating viral infections, most notably herpes, while concurrently fulfilling an essential role in cancer therapeutics. This potent pharmaceutical substance skillfully impedes the unwarranted multiplication of cancer cells, exhibiting profound efficacy in suppressing viral DNA replication.
Supplier | BOC Sciences |
---|---|
Product # | 142234-18-2 |
Pricing | Inquire |
Cas | 142234-18-2 |
Molecular Weight | 745.80 |
Molecular Formula | C39H48N5O8P |
Canonical SMILES | CC1=NN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N |