Methyl 2-Acetyl-3-(4-pyridyl)propanoate
Methyl 2-Acetyl-3-(4-pyridyl)propanoate is an intermediate in the synthesis of Naratriptan 2-Carboxylic Acid (N378745), an impurity of Naratriptan (N378730), which is a triptan drug that is used for the treatment of migraine headaches.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076261 |
| Pricing | Inquire |
| Cas | 874583-30-9 |
| Molecular Weight | 207.23 |
| Molecular Formula | C11H13NO3 |
| Canonical SMILES | CC(=O)C(CC1=CC=NC=C1)C(=O)OC |