2-(D-Gluco-pentylhydroxypentyl)-4(R)-1,3-thiazolidine-4-carboxylic acid
2-(D-Gluco-pentylhydroxypentyl)-4(R)-1,3-thiazolidine-4-carboxylic acid, a remarkable pharmaceutical compound, serves as an exemplary agent in alleviating diabetes and its correlated metabolic irregularities. Its ingenious methodology instigates the activation of peroxisome proliferator-activated receptors (PPARs), thereby ameliorating insulin resistance and effectively overseeing the intricate dynamics of glucose and lipid metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 88271-29-8 |
| Pricing | Inquire |
| Cas | 88271-29-8 |
| Molecular Weight | 297.33 |
| Molecular Formula | C10H19NO7S |
| Canonical SMILES | C1C(NC(S1)C(C(C(C(CO)O)O)O)O)C(=O)O |