3'-Deoxy-3',5-difluorocytidine
3'-Deoxy-3',5-difluorocytidine is an exceptional antiviral compound, playing a paramount role in research of distinct viral ailments like hepatitis C and herpes simplex. By intricately obstructing the compoundion of viral nucleic acids, it remarkably impedes viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 661470-65-1 |
| Pricing | Inquire |
| Cas | 661470-65-1 |
| Molecular Weight | 263.20 |
| Molecular Formula | C9H11F2N3O4 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)F)O)N)F |