N-Benzoyl-5'-O-tritylcytidine
N-Benzoyl-5'-O-tritylcytidine, a nucleoside analogue, has garnered interest in the development of antiviral agents targeting RNA viruses like hepatitis C and HIV. Its potential in the treatment of solid tumors including lung and breast cancer has also been observed. Moreover, this compound's structural attributes make it a valuable asset in the synthesis of modified nucleosides for a slew of biomedical uses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 41092-41-5 |
| Pricing | Inquire |
| Cas | 41092-41-5 |
| Molecular Weight | 589.65 |
| Molecular Formula | C35H31N3O6 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=NC(=O)N(C=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)O)O |