Cy5-PEG5-amine HCl salt
Cy5-PEG5-amine HCl salt is a PEG linker containing a cyanine dye with excitation/emmission maximum 649/667 nm and a free amine group, which will be reactive with cabroxylic acid, activated NHS ester, carbonyl (ketone, aldehyde) etc. The hydophilic PEG spacer increases solubility in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | A17-0163 |
| Pricing | Inquire |
| Molecular Weight | 817.9 |
| Molecular Formula | C44H66Cl2N4O6 |
| Canonical SMILES | CC1(C2=CC=CC=C2[N+](=C1C=CC=CC=C3C(C4=CC=CC=C4N3CCCCCC(=O)NCCOCCOCCOCCOCCOCC[NH3+])(C)C)C)C.[Cl-].[Cl-] |