Benzofuran-6-carboxylic acid
Benzofuran-6-carboxylic Acid (CAS# 77095-51-3) is a reagent in the development of potent LFA-1/ICAM antagonist SAR 118 as an opthalmic solution for treating dry eyes. Preparation of piperidinylpyrimidine derivatives as inhibitors of HIV-1 LTR activation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 77095-51-3 |
| Pricing | Inquire |
| Cas | 77095-51-3 |
| Molecular Weight | 162.14 |
| Molecular Formula | C9H6O3 |
| Canonical SMILES | C1=CC(=CC2=C1C=CO2)C(=O)O |