TC-G 1005
TC-G 1005 is a potent and selective GPBA agonist (EC50 = 0.72 nM for hTGR5) that selectively activates TGR5 over FXR (farnesoid X receptor). TC-G 1005 has been shown to increase plasma GLP-1 level and lower blood glucose level in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1415407-60-1 |
| Pricing | Inquire |
| Cas | 1415407-60-1 |
| Molecular Weight | 399.48 |
| Molecular Formula | C25H25N3O2 |
| Canonical SMILES | CC1=CC(=C(C=C1)C)OC2=C(C=NC=C2)C(=O)N3CCN(C4=CC=CC=C43)C5CC5 |