beta-Zearalanol
It is a minor analogue of the zearalenone family of resorcinyl macrocyclic lactones produced by several species of fusarium. It exhibits estrogenic activity in animals and is a growth promotant for animals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42422-68-4 |
| Pricing | Inquire |
| Cas | 42422-68-4 |
| Molecular Weight | 322.40 |
| Molecular Formula | C18H26O5 |
| Canonical SMILES | CC1CCCC(CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |