MSL-7
MSL-7 is an autophagy enhancer. MSL-7 induced formation of autophagolysosome, TFEB nuclear translocation, and calcineurin activation in a dose-dependent manner. MSL-7 also increased autophagic activity, reduced TFEB phosphorylation at S142 and bound to calcineurin A, protecting its degradation by pronase in DARTS assay.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2172949-70-9 |
| Pricing | Inquire |
| Cas | 2172949-70-9 |
| Molecular Weight | 349.79 |
| Molecular Formula | C16H12ClNO4S |
| Canonical SMILES | COC1=C(N=C(O1)C2=CC=CC=C2Cl)S(=O)(=O)C3=CC=CC=C3 |