(Leu13)-Motilin (human, porcine)
(Leu13)-Motilin (human, porcine) produces an excitatory reaction in the gastrointestinal tract of chickens, with varying sensitivity in different regions. The mechanisms of action are different between the proventriculus and the intestinal segments. Motilin analogues contract intestinal segments by acting directly on smooth muscle cells whereas in the proventriculus it causes contraction and enhancement of electric field stimulation-induced responses by acting on the intramural cholinergic neurons.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015308 |
| Pricing | Inquire |
| Cas | 59530-69-7 |
| Molecular Weight | 2681.01 |
| Molecular Formula | C121H190N34O35 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(C(C)O)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(CCC(=O)N)C(=O)O)NC(=O)C3CCCN3C(=O)C(C(C)C)NC(=O)C(CC4=CC=CC=C4)N |