Ethyl 2',4'-Difluoro-4-hydroxy[1,1'-biphenyl]-3-carboxylate
Ethyl 2',4'-Difluoro-4-hydroxy[1,1'-biphenyl]-3-carboxylate is an intermediate in the synthesis of Diflunisal Sulfate Disodium Salt (D445805) which is a major metabolite of Diflunisal (D445751) which acts as an analgesic agent, used in AlzheimerтАЩs studies (1,2,3) as an anti-inflammatory. As well as in autolytic regulation of human kallikrein -related peptidase 6 (4).
| Supplier | BOC Sciences |
|---|---|
| Product # | BB066026 |
| Pricing | Inquire |
| Cas | 126093-86-5 |
| Molecular Weight | 278.25 |
| Molecular Formula | C15H12F2O3 |
| Canonical SMILES | CCOC(=O)C1=C(C=CC(=C1)C2=C(C=C(C=C2)F)F)O |