Monensin A
Monensin A is an oxygen-containing heterocyclic polyether antibiotic produced by Str. cinnamonensis. It has antibacterial, mycobacterial, fungal and protozoan activity, but it has a weaker effect on gram-negative bacteria and has an inhibitory effect on HeLa cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17090-79-8 |
| Pricing | Inquire |
| Cas | 17090-79-8 |
| Molecular Weight | 670.87 |
| Molecular Formula | C36H62O11 |
| Canonical SMILES | CCC1(CCC(O1)C2(CCC3(O2)CC(C(C(O3)C(C)C(C(C)C(=O)O)OC)C)O)C)C4C(CC(O4)C5C(CC(C(O5)(CO)O)C)C)C |