3-[2-(Dimethylamino)ethyl]-4-indolyl Acetate Fumarate
3-[2-(Dimethylamino)ethyl]-4-indolyl Acetate Fumarate (CAS# 1217230-42-6) is readily crystallized as the fumarate salt, and is considerably more stable than Psilocin (P839630) itself. It would seem to be an ideal prodrug to replace Psilocybin in future clinical studies, since Psilocin is the principal metabolite of Psilocibin.Controlled substance (hallucinogen).
| Supplier | BOC Sciences |
|---|---|
| Product # | BB005247 |
| Pricing | Inquire |
| Cas | 1217230-42-6 |
| Molecular Weight | 362.38 |
| Molecular Formula | C18H22N2O6 |
| Canonical SMILES | CC(=O)OC1=CC=CC2=C1C(=CN2)CCN(C)C.C(=CC(=O)O)C(=O)O |