N1-b-D-Glucopyranosylamino-guanidine HNO3
N1-b-D-Glucopyranosylamino-guanidine HNO3, a biomedical compound extensively utilized for diabetes treatment, exerts its efficacy as a potent hypoglycemic agent. Its mechanism involves the inhibition of the α-glucosidase enzyme, effectively retarding carbohydrate breakdown and absorption. Remarkably, this compound exhibits promise in regulating postprandial glucose levels and ameliorating insulin resistance among diabetic individuals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109853-83-0 |
| Pricing | Inquire |
| Cas | 109853-83-0 |
| Molecular Weight | 299.24 |
| Molecular Formula | C7H17N5O8 |
| Canonical SMILES | C(C1C(C(C(C(O1)NN=C(N)N)O)O)O)O.[N+](=O)(O)[O-] |