3'-Amino-2',3'-dideoxyguanosine
3'-Amino-2',3'-dideoxyguanosine, a paramount compound employed in the biomedical sector, emerges as a nucleoside analog imbued with remarkable antiviral traits. Its capacity to curtail the replication of diverse RNA viruses, such as HIV, renders it a subject of extensive analysis within the realm of combating viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66323-49-7 |
| Pricing | Inquire |
| Cas | 66323-49-7 |
| Molecular Weight | 266.25 |
| Molecular Formula | C10H14N6O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)N |