(2-HYDROXYPHENYL)BIS(4-HYDROXY-2,3,5-TRIMETHYLPHENYL)METHANE
(2-Hydroxyphenyl)Bis(4-hydroxy-2,3,5-trimethylphenyl)Methane, also known as Bisphenol F, is primarily utilized in the production of epoxy resins used in the medical field. Its antibacterial properties make it beneficial for drug development efforts targeting bacterial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 184355-68-8 |
| Pricing | Inquire |
| Cas | 184355-68-8 |
| Molecular Weight | 376.49 |
| Molecular Formula | C25H28O3 |
| Canonical SMILES | CC1=CC(=C(C(=C1O)C)C)C(C2=CC=CC=C2O)C3=C(C(=C(C(=C3)C)O)C)C |