N-Acetyl-3-iodo-L-tyrosine hemihydrate
N-Acetyl-3-iodo-L-tyrosine hemihydrate, a chemical reagent with notable significance in studying enzyme inhibitors and protein synthesis, is widely utilized in the medical research community to develop promising drug therapies for thyroid disorders and cancers. Such compounds may also be used to synthesize radioiodinated compounds, essential in the realm of medical imaging and diagnostics.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-115435 |
| Pricing | Inquire |
| Cas | 23277-49-8 |
| Molecular Weight | 716.3 |
| Molecular Formula | C22H26I2N2O9 |
| Canonical SMILES | CC(=O)NC(CC1=CC(=C(C=C1)O)I)C(=O)O.CC(=O)NC(CC1=CC(=C(C=C1)O)I)C(=O)O.O |