5'(R)-C-Methylcytidine
5'(R)-C-Methylcytidine is a prominent pharmaceutical compound utilized in the compound sector, playing a crucial role in research of viral infections, especially those affecting the respiratory system. By effectively impeding viral replication, this compound emerges as a formidable force in diminishing the infection's intensity and duration. With its distinctive configuration and intricate mode of operation, it becomes an auspicious contender in the realm of antiviral drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72159-53-6 |
| Pricing | Inquire |
| Cas | 72159-53-6 |
| Molecular Weight | 257.24 |
| Molecular Formula | C10H15N3O5 |
| Canonical SMILES | CC(C1C(C(C(O1)N2C=CC(=NC2=O)N)O)O)O |