3-Acetylphenylboronic Acid
3-Acetylphenylboronic acid can be used as a substrate: In the synthesis of symmetric biaryls via oxidative dimerization using a palladium catalyst and water as a solvent; In the synthesis of aryl fluorides through electrophilic fluorination reaction using acetyl hypofluorite; In the coupling reactions of organoboranes with olefins using molecular oxygen and palladium catalyst.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB016001 |
| Pricing | Inquire |
| Cas | 204841-19-0 |
| Molecular Weight | 163.97 |
| Molecular Formula | C8H9O3B |
| Canonical SMILES | B(C1=CC(=CC=C1)C(=O)C)(O)O |