5'-O-(Dimethoxytrityl)-O4-(toluoyl)-2-thiothymidine
5'-O-(Dimethoxytrityl)-O4-(toluoyl)-2-thiothymidine is a modified nucleoside widely used in the biomedical industry. It serving as a building block in the synthesis of oligonucleotides for various research purposes, including drug development and disease diagnostics. Its modification enhances stability and allows selective targeting of specific genes or RNA molecules, making it valuable in studies related to cancer research and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 156783-13-0 |
| Pricing | Inquire |
| Cas | 156783-13-0 |
| Molecular Weight | 678.80 |
| Molecular Formula | C39H38N2O7S |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OC2=NC(=S)N(C=C2C)C3CC(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |